About 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile
2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile (PubChem CID 167255752) has the molecular formula C12H5F8N
and a molecular weight of 315.16 g/mol. Its IUPAC name is 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile |
| PubChem CID | 167255752 |
| Molecular Formula | C12H5F8N |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile |
| SMILES | C=Cc1c(F)c(C(F)(F)F)c(CC#N)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C12H5F8N/c1-2-5-7(11(15,16)17)10(14)6(3-4-21)8(9(5)13)12(18,19)20/h2H,1,3H2 |
| InChIKey | VGGMOOHCXDOVAC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile?
The IUPAC name of 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile (CID 167255752) is 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile.
What is the SMILES notation for 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile?
The canonical SMILES for 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile is C=Cc1c(F)c(C(F)(F)F)c(CC#N)c(F)c1C(F)(F)F.
What is the InChIKey of 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile?
The InChIKey is VGGMOOHCXDOVAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5F8N/c1-2-5-7(11(15,16)17)10(14)6(3-4-21)8(9(5)13)12(18,19)20/h2H,1,3H2.
What are the key properties of 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile?
2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile has a molecular weight of 315.16 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-ethenyl-2,5-difluoro-3,6-bis(trifluoromethyl)phenyl]acetonitrile is sourced from PubChem (CID 167255752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).