C15H19N — CID 167255843
4-(1,2,4-trimethylcyclohexa-2,4-dien-1-yl)aniline (PubChem CID 167255843) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-(1,2,4-trimethylcyclohexa-2,4-dien-1-yl)aniline.
| Compound Name | 4-(1,2,4-trimethylcyclohexa-2,4-dien-1-yl)aniline |
|---|---|
| PubChem CID | 167255843 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 4-(1,2,4-trimethylcyclohexa-2,4-dien-1-yl)aniline |
| SMILES | CC1=CCC(C)(c2ccc(N)cc2)C(C)=C1 |
| InChI | InChI=1S/C15H19N/c1-11-8-9-15(3,12(2)10-11)13-4-6-14(16)7-5-13/h4-8,10H,9,16H2,1-3H3 |
| InChIKey | CFXUVMULSOYGML-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|