C33H35F2N7O5 — CID 167256213
3,4-difluoro-N-[5-[1-(4-methoxybutyl)-2,6-dioxo-3-propyl-7H-purin-8-yl]-2-pyridinyl]-N-[3-(2-oxo-1-pyridinyl)propyl]benzamide (PubChem CID 167256213) has the molecular formula C33H35F2N7O5 and a molecular weight of 647.68 g/mol. Its IUPAC name is 3,4-difluoro-N-[5-[1-(4-methoxybutyl)-2,6-dioxo-3-propyl-7H-purin-8-yl]-2-pyridinyl]-N-[3-(2-oxo-1-pyridinyl)propyl]benzamide.
| Compound Name | 3,4-difluoro-N-[5-[1-(4-methoxybutyl)-2,6-dioxo-3-propyl-7H-purin-8-yl]-2-pyridinyl]-N-[3-(2-oxo-1-pyridinyl)propyl]benzamide |
|---|---|
| PubChem CID | 167256213 |
| Molecular Formula | C33H35F2N7O5 |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | 3,4-difluoro-N-[5-[1-(4-methoxybutyl)-2,6-dioxo-3-propyl-7H-purin-8-yl]-2-pyridinyl]-N-[3-(2-oxo-1-pyridinyl)propyl]benzamide |
| SMILES | CCCn1c(=O)n(CCCCOC)c(=O)c2[nH]c(-c3ccc(N(CCCn4ccccc4=O)C(=O)c4ccc(F)c(F)c4)nc3)nc21 |
| InChI | InChI=1S/C33H35F2N7O5/c1-3-14-41-30-28(32(45)42(33(41)46)17-6-7-19-47-2)37-29(38-30)23-11-13-26(36-21-23)40(18-8-16-39-15-5-4-9-27(39)43)31(44)22-10-12-24(34)25(35)20-22/h4-5,9-13,15,20-21H,3,6-8,14,16-19H2,1-2H3,(H,37,38) |
| InChIKey | AYVQAVHANICZGD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|