C12H15FS — CID 167256222
(2E,4E,7E,9Z)-4-fluorododeca-2,4,7,9,11-pentaene-3-thiol (PubChem CID 167256222) has the molecular formula C12H15FS and a molecular weight of 210.32 g/mol. Its IUPAC name is (2E,4E,7E,9Z)-4-fluorododeca-2,4,7,9,11-pentaene-3-thiol.
| Compound Name | (2E,4E,7E,9Z)-4-fluorododeca-2,4,7,9,11-pentaene-3-thiol |
|---|---|
| PubChem CID | 167256222 |
| Molecular Formula | C12H15FS |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2E,4E,7E,9Z)-4-fluorododeca-2,4,7,9,11-pentaene-3-thiol |
| SMILES | C=C/C=C\C=C\C/C=C(F)\C(S)=C/C |
| InChI | InChI=1S/C12H15FS/c1-3-5-6-7-8-9-10-11(13)12(14)4-2/h3-8,10,14H,1,9H2,2H3/b6-5-,8-7+,11-10+,12-4+ |
| InChIKey | ILOTWSNIIZGJGW-SFRNXLOXSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|