C19H19F2N5O3S2 — CID 16725683
[4-amino-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]-(5,6-difluoro-1-benzofuran-7-yl)methanethione (PubChem CID 16725683) has the molecular formula C19H19F2N5O3S2 and a molecular weight of 467.52 g/mol. Its IUPAC name is [4-amino-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]-(5,6-difluoro-1-benzofuran-7-yl)methanethione.
| Compound Name | [4-amino-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]-(5,6-difluoro-1-benzofuran-7-yl)methanethione |
|---|---|
| PubChem CID | 16725683 |
| Molecular Formula | C19H19F2N5O3S2 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | [4-amino-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]-(5,6-difluoro-1-benzofuran-7-yl)methanethione |
| SMILES | CS(=O)(=O)N1CCC(Nc2ncc(C(=S)c3c(F)c(F)cc4ccoc34)c(N)n2)CC1 |
| InChI | InChI=1S/C19H19F2N5O3S2/c1-31(27,28)26-5-2-11(3-6-26)24-19-23-9-12(18(22)25-19)17(30)14-15(21)13(20)8-10-4-7-29-16(10)14/h4,7-9,11H,2-3,5-6H2,1H3,(H3,22,23,24,25) |
| InChIKey | WCADXDDKPJPNEC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|