C18H18F2N6O3S2 — CID 16725684
[4-amino-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]-(5,6-difluoro-1,3-benzoxazol-7-yl)methanethione (PubChem CID 16725684) has the molecular formula C18H18F2N6O3S2 and a molecular weight of 468.51 g/mol. Its IUPAC name is [4-amino-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]-(5,6-difluoro-1,3-benzoxazol-7-yl)methanethione.
| Compound Name | [4-amino-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]-(5,6-difluoro-1,3-benzoxazol-7-yl)methanethione |
|---|---|
| PubChem CID | 16725684 |
| Molecular Formula | C18H18F2N6O3S2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | [4-amino-2-[(1-methylsulfonylpiperidin-4-yl)amino]pyrimidin-5-yl]-(5,6-difluoro-1,3-benzoxazol-7-yl)methanethione |
| SMILES | CS(=O)(=O)N1CCC(Nc2ncc(C(=S)c3c(F)c(F)cc4ncoc34)c(N)n2)CC1 |
| InChI | InChI=1S/C18H18F2N6O3S2/c1-31(27,28)26-4-2-9(3-5-26)24-18-22-7-10(17(21)25-18)16(30)13-14(20)11(19)6-12-15(13)29-8-23-12/h6-9H,2-5H2,1H3,(H3,21,22,24,25) |
| InChIKey | KWNOVDHYIBPEPS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|