C9H10F5N — CID 167256994
N-methyl-4-(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,3-dien-1-amine (PubChem CID 167256994) has the molecular formula C9H10F5N and a molecular weight of 227.18 g/mol. Its IUPAC name is N-methyl-4-(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,3-dien-1-amine.
| Compound Name | N-methyl-4-(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 167256994 |
| Molecular Formula | C9H10F5N |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-methyl-4-(1,1,2,2,2-pentafluoroethyl)cyclohexa-1,3-dien-1-amine |
| SMILES | CNC1=CC=C(C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H10F5N/c1-15-7-4-2-6(3-5-7)8(10,11)9(12,13)14/h2,4,15H,3,5H2,1H3 |
| InChIKey | WDIZPBAQTZLEGI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|