C55H39NO2 — CID 167257270
N,N-bis(4-dibenzofuran-3-ylphenyl)-4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]aniline (PubChem CID 167257270) has the molecular formula C55H39NO2 and a molecular weight of 745.92 g/mol. Its IUPAC name is N,N-bis(4-dibenzofuran-3-ylphenyl)-4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]aniline.
| Compound Name | N,N-bis(4-dibenzofuran-3-ylphenyl)-4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]aniline |
|---|---|
| PubChem CID | 167257270 |
| Molecular Formula | C55H39NO2 |
| Molecular Weight | 745.92 g/mol |
| Exact Mass | 745.30 |
| IUPAC Name | N,N-bis(4-dibenzofuran-3-ylphenyl)-4-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]aniline |
| SMILES | C=C/C=C(\C=C/C)c1ccc(-c2ccc(N(c3ccc(-c4ccc5c(c4)oc4ccccc45)cc3)c3ccc(-c4ccc5c(c4)oc4ccccc45)cc3)cc2)cc1 |
| InChI | InChI=1S/C55H39NO2/c1-3-9-37(10-4-2)38-15-17-39(18-16-38)40-19-27-45(28-20-40)56(46-29-21-41(22-30-46)43-25-33-50-48-11-5-7-13-52(48)57-54(50)35-43)47-31-23-42(24-32-47)44-26-34-51-49-12-6-8-14-53(49)58-55(51)36-44/h3-36H,1H2,2H3/b10-4-,37-9+ |
| InChIKey | PWOYITAHTKFILF-MGCSXGBASA-N |
| XLogP | 16.10 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.92 |
| LogP ≤ 5 | 16.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|