C29H44O6 — CID 16725728
[(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R,4R)-4-(oxan-2-yloxy)-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate (PubChem CID 16725728) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R,4R)-4-(oxan-2-yloxy)-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R,4R)-4-(oxan-2-yloxy)-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 16725728 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(2R,4R)-4-(oxan-2-yloxy)-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](OC4CCCCO4)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C29H44O6/c1-5-19(3)29(31)35-25-15-18(2)14-21-10-9-20(4)24(28(21)25)12-11-22-16-23(17-26(30)33-22)34-27-8-6-7-13-32-27/h9-10,14,18-20,22-25,27-28H,5-8,11-13,15-17H2,1-4H3/t18-,19-,20-,22+,23+,24-,25-,27?,28-/m0/s1 |
| InChIKey | FSKRMBPKPQGCOD-DJOHHXPVSA-N |
| XLogP | 5.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |