C28H52N2O4 — CID 16725766
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-methylpropanedioate (PubChem CID 16725766) has the molecular formula C28H52N2O4 and a molecular weight of 480.73 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-methylpropanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-methylpropanedioate |
|---|---|
| PubChem CID | 16725766 |
| Molecular Formula | C28H52N2O4 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-methylpropanedioate |
| SMILES | CCCCC(C)(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C28H52N2O4/c1-13-14-15-28(10,22(31)33-20-16-24(2,3)29(11)25(4,5)17-20)23(32)34-21-18-26(6,7)30(12)27(8,9)19-21/h20-21H,13-19H2,1-12H3 |
| InChIKey | ISYIYEKQIQVSBL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|