About 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile
2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile (PubChem CID 167257849) has the molecular formula C9H5F2N3S
and a molecular weight of 225.22 g/mol. Its IUPAC name is 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile |
| PubChem CID | 167257849 |
| Molecular Formula | C9H5F2N3S |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(N)sc2c(F)cc(F)c(N)c12 |
| InChI | InChI=1S/C9H5F2N3S/c10-4-1-5(11)8-6(7(4)13)3(2-12)9(14)15-8/h1H,13-14H2 |
| InChIKey | NNSATLLRWTZHKK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile?
The IUPAC name of 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile (CID 167257849) is 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile.
What is the SMILES notation for 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile?
The canonical SMILES for 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile is N#Cc1c(N)sc2c(F)cc(F)c(N)c12.
What is the InChIKey of 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile?
The InChIKey is NNSATLLRWTZHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F2N3S/c10-4-1-5(11)8-6(7(4)13)3(2-12)9(14)15-8/h1H,13-14H2.
What are the key properties of 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile?
2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile has a molecular weight of 225.22 g/mol, XLogP of 2.22, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-5,7-difluoro-1-benzothiophene-3-carbonitrile is sourced from PubChem (CID 167257849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).