C14H23N3 — CID 167258040
3-hexan-2-yl-4,5-bis[(Z)-prop-1-enyl]-1,2,4-triazole (PubChem CID 167258040) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 3-hexan-2-yl-4,5-bis[(Z)-prop-1-enyl]-1,2,4-triazole.
| Compound Name | 3-hexan-2-yl-4,5-bis[(Z)-prop-1-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 167258040 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 3-hexan-2-yl-4,5-bis[(Z)-prop-1-enyl]-1,2,4-triazole |
| SMILES | C/C=C\c1nnc(C(C)CCCC)n1/C=C\C |
| InChI | InChI=1S/C14H23N3/c1-5-8-10-12(4)14-16-15-13(9-6-2)17(14)11-7-3/h6-7,9,11-12H,5,8,10H2,1-4H3/b9-6-,11-7- |
| InChIKey | WEKBZXCOGAPWKI-TVBMFEEWSA-N |
| XLogP | 4.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |