About 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine
4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 167258244) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine |
| PubChem CID | 167258244 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | C=C1CCc2cc(C3=CCN(C(=C)C)CC3)ccc21 |
| InChI | InChI=1S/C18H21N/c1-13(2)19-10-8-15(9-11-19)16-6-7-18-14(3)4-5-17(18)12-16/h6-8,12H,1,3-5,9-11H2,2H3 |
| InChIKey | NKOHCLFNXNGYIT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine (CID 167258244) is 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine is C=C1CCc2cc(C3=CCN(C(=C)C)CC3)ccc21.
What is the InChIKey of 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine?
The InChIKey is NKOHCLFNXNGYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N/c1-13(2)19-10-8-15(9-11-19)16-6-7-18-14(3)4-5-17(18)12-16/h6-8,12H,1,3-5,9-11H2,2H3.
What are the key properties of 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine?
4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine has a molecular weight of 251.37 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methylidene-2,3-dihydroinden-5-yl)-1-prop-1-en-2-yl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 167258244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).