C25H19NO6S — CID 16725848
2-[5-[4-[[3-(2,3,4-trihydroxyphenyl)benzoyl]amino]phenyl]thiophen-2-yl]acetic acid (PubChem CID 16725848) has the molecular formula C25H19NO6S and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-[5-[4-[[3-(2,3,4-trihydroxyphenyl)benzoyl]amino]phenyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[4-[[3-(2,3,4-trihydroxyphenyl)benzoyl]amino]phenyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 16725848 |
| Molecular Formula | C25H19NO6S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 2-[5-[4-[[3-(2,3,4-trihydroxyphenyl)benzoyl]amino]phenyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2ccc(NC(=O)c3cccc(-c4ccc(O)c(O)c4O)c3)cc2)s1 |
| InChI | InChI=1S/C25H19NO6S/c27-20-10-9-19(23(30)24(20)31)15-2-1-3-16(12-15)25(32)26-17-6-4-14(5-7-17)21-11-8-18(33-21)13-22(28)29/h1-12,27,30-31H,13H2,(H,26,32)(H,28,29) |
| InChIKey | SERRSGRGANILJR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|