C24H31N — CID 167258961
1-benzyl-4-(3-ethyl-4-prop-1-en-2-ylphenyl)-2-methylpiperidine (PubChem CID 167258961) has the molecular formula C24H31N and a molecular weight of 333.52 g/mol. Its IUPAC name is 1-benzyl-4-(3-ethyl-4-prop-1-en-2-ylphenyl)-2-methylpiperidine.
| Compound Name | 1-benzyl-4-(3-ethyl-4-prop-1-en-2-ylphenyl)-2-methylpiperidine |
|---|---|
| PubChem CID | 167258961 |
| Molecular Formula | C24H31N |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 1-benzyl-4-(3-ethyl-4-prop-1-en-2-ylphenyl)-2-methylpiperidine |
| SMILES | C=C(C)c1ccc(C2CCN(Cc3ccccc3)C(C)C2)cc1CC |
| InChI | InChI=1S/C24H31N/c1-5-21-16-22(11-12-24(21)18(2)3)23-13-14-25(19(4)15-23)17-20-9-7-6-8-10-20/h6-12,16,19,23H,2,5,13-15,17H2,1,3-4H3 |
| InChIKey | CRXKLGNDHKMWEC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |