C26H32F2N4O3 — CID 167259509
4-[4-[[(1R)-1-[3-amino-5-(1,1-difluoro-2-methoxyethyl)phenyl]ethyl]amino]-2,8-dimethylquinazolin-6-yl]oxan-4-ol (PubChem CID 167259509) has the molecular formula C26H32F2N4O3 and a molecular weight of 486.56 g/mol. Its IUPAC name is 4-[4-[[(1R)-1-[3-amino-5-(1,1-difluoro-2-methoxyethyl)phenyl]ethyl]amino]-2,8-dimethylquinazolin-6-yl]oxan-4-ol.
| Compound Name | 4-[4-[[(1R)-1-[3-amino-5-(1,1-difluoro-2-methoxyethyl)phenyl]ethyl]amino]-2,8-dimethylquinazolin-6-yl]oxan-4-ol |
|---|---|
| PubChem CID | 167259509 |
| Molecular Formula | C26H32F2N4O3 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 4-[4-[[(1R)-1-[3-amino-5-(1,1-difluoro-2-methoxyethyl)phenyl]ethyl]amino]-2,8-dimethylquinazolin-6-yl]oxan-4-ol |
| SMILES | COCC(F)(F)c1cc(N)cc([C@@H](C)Nc2nc(C)nc3c(C)cc(C4(O)CCOCC4)cc23)c1 |
| InChI | InChI=1S/C26H32F2N4O3/c1-15-9-19(25(33)5-7-35-8-6-25)13-22-23(15)31-17(3)32-24(22)30-16(2)18-10-20(12-21(29)11-18)26(27,28)14-34-4/h9-13,16,33H,5-8,14,29H2,1-4H3,(H,30,31,32)/t16-/m1/s1 |
| InChIKey | SUEFOXVMUYSZED-MRXNPFEDSA-N |
| XLogP | 4.74 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|