C11H13F2NO2 — CID 167259987
N,4-diethyl-2,2-difluoro-1,3-benzodioxol-5-amine (PubChem CID 167259987) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is N,4-diethyl-2,2-difluoro-1,3-benzodioxol-5-amine.
| Compound Name | N,4-diethyl-2,2-difluoro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 167259987 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N,4-diethyl-2,2-difluoro-1,3-benzodioxol-5-amine |
| SMILES | CCNc1ccc2c(c1CC)OC(F)(F)O2 |
| InChI | InChI=1S/C11H13F2NO2/c1-3-7-8(14-4-2)5-6-9-10(7)16-11(12,13)15-9/h5-6,14H,3-4H2,1-2H3 |
| InChIKey | TWYWSPQPWGPWIS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|