C26H48N2 — CID 167260414
1-heptan-3-yl-7-nonan-5-yl-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine (PubChem CID 167260414) has the molecular formula C26H48N2 and a molecular weight of 388.68 g/mol. Its IUPAC name is 1-heptan-3-yl-7-nonan-5-yl-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine.
| Compound Name | 1-heptan-3-yl-7-nonan-5-yl-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine |
|---|---|
| PubChem CID | 167260414 |
| Molecular Formula | C26H48N2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.38 |
| IUPAC Name | 1-heptan-3-yl-7-nonan-5-yl-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine |
| SMILES | CCCCC(CC)C1=NNC=C2CCC(C(CCCC)CCCC)CCCC21 |
| InChI | InChI=1S/C26H48N2/c1-5-9-13-21(8-4)26-25-17-12-16-23(18-19-24(25)20-27-28-26)22(14-10-6-2)15-11-7-3/h20-23,25,27H,5-19H2,1-4H3 |
| InChIKey | AXGRIPPDZGFVEJ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |