About 4-(ethenyldiazenyl)-2,5-dimethylphenol
4-(ethenyldiazenyl)-2,5-dimethylphenol (PubChem CID 167260636) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-(ethenyldiazenyl)-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-(ethenyldiazenyl)-2,5-dimethylphenol |
| PubChem CID | 167260636 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-(ethenyldiazenyl)-2,5-dimethylphenol |
| SMILES | C=C/N=N/c1cc(C)c(O)cc1C |
| InChI | InChI=1S/C10H12N2O/c1-4-11-12-9-5-8(3)10(13)6-7(9)2/h4-6,13H,1H2,2-3H3/b12-11+ |
| InChIKey | OIDKLQAQPZLVQT-VAWYXSNFSA-N |
| XLogP | 3.24 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethenyldiazenyl)-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethenyldiazenyl)-2,5-dimethylphenol?
The IUPAC name of 4-(ethenyldiazenyl)-2,5-dimethylphenol (CID 167260636) is 4-(ethenyldiazenyl)-2,5-dimethylphenol.
What is the SMILES notation for 4-(ethenyldiazenyl)-2,5-dimethylphenol?
The canonical SMILES for 4-(ethenyldiazenyl)-2,5-dimethylphenol is C=C/N=N/c1cc(C)c(O)cc1C.
What is the InChIKey of 4-(ethenyldiazenyl)-2,5-dimethylphenol?
The InChIKey is OIDKLQAQPZLVQT-VAWYXSNFSA-N. The full InChI is InChI=1S/C10H12N2O/c1-4-11-12-9-5-8(3)10(13)6-7(9)2/h4-6,13H,1H2,2-3H3/b12-11+.
What are the key properties of 4-(ethenyldiazenyl)-2,5-dimethylphenol?
4-(ethenyldiazenyl)-2,5-dimethylphenol has a molecular weight of 176.22 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethenyldiazenyl)-2,5-dimethylphenol is sourced from PubChem (CID 167260636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).