About 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine
4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine (PubChem CID 167260692) has the molecular formula C15H13NS
and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine |
| PubChem CID | 167260692 |
| Molecular Formula | C15H13NS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine |
| SMILES | Cc1cc(C)cc(-c2nccc3sccc23)c1 |
| InChI | InChI=1S/C15H13NS/c1-10-7-11(2)9-12(8-10)15-13-4-6-17-14(13)3-5-16-15/h3-9H,1-2H3 |
| InChIKey | HCEBXYJOGYWWGH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine?
The IUPAC name of 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine (CID 167260692) is 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine.
What is the SMILES notation for 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine?
The canonical SMILES for 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine is Cc1cc(C)cc(-c2nccc3sccc23)c1.
What is the InChIKey of 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine?
The InChIKey is HCEBXYJOGYWWGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NS/c1-10-7-11(2)9-12(8-10)15-13-4-6-17-14(13)3-5-16-15/h3-9H,1-2H3.
What are the key properties of 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine?
4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine has a molecular weight of 239.34 g/mol, XLogP of 4.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylphenyl)thieno[3,2-c]pyridine is sourced from PubChem (CID 167260692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).