C10H14N2O5S2 — CID 167260970
2-[2-[2-(5-methyl-2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 167260970) has the molecular formula C10H14N2O5S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[2-[2-(5-methyl-2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[2-(5-methyl-2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 167260970 |
| Molecular Formula | C10H14N2O5S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-[2-[2-(5-methyl-2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CC1SC(=O)N(CCNC(=O)CSCC(=O)O)C1=O |
| InChI | InChI=1S/C10H14N2O5S2/c1-6-9(16)12(10(17)19-6)3-2-11-7(13)4-18-5-8(14)15/h6H,2-5H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | LEFCAPNPBHVTSX-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|