C24H17NO7 — CID 16726128
dimethyl 1',3'-dioxospiro[11bH-[1,3]oxazino[2,3-a]isoquinoline-2,2'-indene]-3,4-dicarboxylate (PubChem CID 16726128) has the molecular formula C24H17NO7 and a molecular weight of 431.40 g/mol. Its IUPAC name is dimethyl 1',3'-dioxospiro[11bH-[1,3]oxazino[2,3-a]isoquinoline-2,2'-indene]-3,4-dicarboxylate.
| Compound Name | dimethyl 1',3'-dioxospiro[11bH-[1,3]oxazino[2,3-a]isoquinoline-2,2'-indene]-3,4-dicarboxylate |
|---|---|
| PubChem CID | 16726128 |
| Molecular Formula | C24H17NO7 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | dimethyl 1',3'-dioxospiro[11bH-[1,3]oxazino[2,3-a]isoquinoline-2,2'-indene]-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(OC3c4ccccc4C=CN13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H17NO7/c1-30-22(28)17-18(23(29)31-2)25-12-11-13-7-3-4-8-14(13)21(25)32-24(17)19(26)15-9-5-6-10-16(15)20(24)27/h3-12,21H,1-2H3 |
| InChIKey | MVAWJOLTDSGIMR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|