C14H15ClF3N3O — CID 167261585
2-[6-chloro-1-(1,1,1-trifluoropropan-2-yloxy)-2,7-naphthyridin-4-yl]propan-2-amine (PubChem CID 167261585) has the molecular formula C14H15ClF3N3O and a molecular weight of 333.74 g/mol. Its IUPAC name is 2-[6-chloro-1-(1,1,1-trifluoropropan-2-yloxy)-2,7-naphthyridin-4-yl]propan-2-amine.
| Compound Name | 2-[6-chloro-1-(1,1,1-trifluoropropan-2-yloxy)-2,7-naphthyridin-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 167261585 |
| Molecular Formula | C14H15ClF3N3O |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[6-chloro-1-(1,1,1-trifluoropropan-2-yloxy)-2,7-naphthyridin-4-yl]propan-2-amine |
| SMILES | CC(Oc1ncc(C(C)(C)N)c2cc(Cl)ncc12)C(F)(F)F |
| InChI | InChI=1S/C14H15ClF3N3O/c1-7(14(16,17)18)22-12-9-5-20-11(15)4-8(9)10(6-21-12)13(2,3)19/h4-7H,19H2,1-3H3 |
| InChIKey | QEOSSIKVBSIHDA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|