C11H14ClNO — CID 167261652
(7S,8R)-2-chloro-7-ethyl-8-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine (PubChem CID 167261652) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is (7S,8R)-2-chloro-7-ethyl-8-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine.
| Compound Name | (7S,8R)-2-chloro-7-ethyl-8-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine |
|---|---|
| PubChem CID | 167261652 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (7S,8R)-2-chloro-7-ethyl-8-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridine |
| SMILES | CC[C@@H]1OCc2ccc(Cl)nc2[C@H]1C |
| InChI | InChI=1S/C11H14ClNO/c1-3-9-7(2)11-8(6-14-9)4-5-10(12)13-11/h4-5,7,9H,3,6H2,1-2H3/t7-,9-/m0/s1 |
| InChIKey | OVTDFDMYEKMHEL-CBAPKCEASA-N |
| XLogP | 3.15 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|