About (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one
(7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one (PubChem CID 167261699) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one |
| PubChem CID | 167261699 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one |
| SMILES | CC[C@]1(C)OC(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C11H13NO2/c1-4-11(3)9-8(10(13)14-11)6-5-7(2)12-9/h5-6H,4H2,1-3H3/t11-/m0/s1 |
| InChIKey | NABAZBDBSRWMGC-NSHDSACASA-N |
| XLogP | 2.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one?
The IUPAC name of (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one (CID 167261699) is (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one.
What is the SMILES notation for (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one?
The canonical SMILES for (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one is CC[C@]1(C)OC(=O)c2ccc(C)nc21.
What is the InChIKey of (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one?
The InChIKey is NABAZBDBSRWMGC-NSHDSACASA-N. The full InChI is InChI=1S/C11H13NO2/c1-4-11(3)9-8(10(13)14-11)6-5-7(2)12-9/h5-6H,4H2,1-3H3/t11-/m0/s1.
What are the key properties of (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one?
(7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one has a molecular weight of 191.23 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-ethyl-2,7-dimethylfuro[3,4-b]pyridin-5-one is sourced from PubChem (CID 167261699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).