C14H22O4 — CID 167261908
(3,5-dimethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2-methylbutanoate (PubChem CID 167261908) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (3,5-dimethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2-methylbutanoate.
| Compound Name | (3,5-dimethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 167261908 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (3,5-dimethyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C(C)CC2C(C)C(=O)OC21 |
| InChI | InChI=1S/C14H22O4/c1-5-7(2)13(15)17-11-8(3)6-10-9(4)14(16)18-12(10)11/h7-12H,5-6H2,1-4H3 |
| InChIKey | FIJFXVFTEHQDNN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |