C22H30O2 — CID 167262040
2,3,4,5-tetramethyl-6-[2-(2,3,5,6-tetramethyl-4-oxocyclohexa-1,5-dien-1-yl)ethyl]cyclohexa-2,5-dien-1-one (PubChem CID 167262040) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-6-[2-(2,3,5,6-tetramethyl-4-oxocyclohexa-1,5-dien-1-yl)ethyl]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,3,4,5-tetramethyl-6-[2-(2,3,5,6-tetramethyl-4-oxocyclohexa-1,5-dien-1-yl)ethyl]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 167262040 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2,3,4,5-tetramethyl-6-[2-(2,3,5,6-tetramethyl-4-oxocyclohexa-1,5-dien-1-yl)ethyl]cyclohexa-2,5-dien-1-one |
| SMILES | CC1=C(C)C(CCC2=C(C)C(C)C(C)=C(C)C2=O)=C(C)C(C)C1=O |
| InChI | InChI=1S/C22H30O2/c1-11-12(2)16(6)22(24)20(13(11)3)10-9-19-14(4)17(7)21(23)18(8)15(19)5/h11,17H,9-10H2,1-8H3 |
| InChIKey | RUTWRWLWIBTWOQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |