C19H22N2O3 — CID 16726269
ethyl (3R)-3-[[(1R)-2-amino-2-oxo-1-phenylethyl]amino]-3-phenylpropanoate (PubChem CID 16726269) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is ethyl (3R)-3-[[(1R)-2-amino-2-oxo-1-phenylethyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (3R)-3-[[(1R)-2-amino-2-oxo-1-phenylethyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 16726269 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | ethyl (3R)-3-[[(1R)-2-amino-2-oxo-1-phenylethyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C[C@@H](N[C@@H](C(N)=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-24-17(22)13-16(14-9-5-3-6-10-14)21-18(19(20)23)15-11-7-4-8-12-15/h3-12,16,18,21H,2,13H2,1H3,(H2,20,23)/t16-,18-/m1/s1 |
| InChIKey | MZEMOQWIQYXCSY-SJLPKXTDSA-N |
| XLogP | 2.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |