About (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane
(2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane (PubChem CID 16726276) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane.
Molecular Properties
| Compound Name | (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane |
| PubChem CID | 16726276 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane |
| SMILES | C[C@H]1CCC[C@@](C)(/C=C/C2CCCCC2)O1 |
| InChI | InChI=1S/C15H26O/c1-13-7-6-11-15(2,16-13)12-10-14-8-4-3-5-9-14/h10,12-14H,3-9,11H2,1-2H3/b12-10+/t13-,15-/m0/s1 |
| InChIKey | PLGWBXJRYXEXMU-PYHCZJRBSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane?
The IUPAC name of (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane (CID 16726276) is (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane.
What is the SMILES notation for (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane?
The canonical SMILES for (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane is C[C@H]1CCC[C@@](C)(/C=C/C2CCCCC2)O1.
What is the InChIKey of (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane?
The InChIKey is PLGWBXJRYXEXMU-PYHCZJRBSA-N. The full InChI is InChI=1S/C15H26O/c1-13-7-6-11-15(2,16-13)12-10-14-8-4-3-5-9-14/h10,12-14H,3-9,11H2,1-2H3/b12-10+/t13-,15-/m0/s1.
What are the key properties of (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane?
(2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane has a molecular weight of 222.37 g/mol, XLogP of 4.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-2-[(E)-2-cyclohexylethenyl]-2,6-dimethyloxane is sourced from PubChem (CID 16726276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).