C23H29ClN2O5 — CID 167262815
6-[6-chloro-5-(3-methoxypropoxy)-3-methyl-2-pyridinyl]-1-[(1S)-2,2-dimethylcyclopentyl]-4-oxopyridine-3-carboxylic acid (PubChem CID 167262815) has the molecular formula C23H29ClN2O5 and a molecular weight of 448.95 g/mol. Its IUPAC name is 6-[6-chloro-5-(3-methoxypropoxy)-3-methyl-2-pyridinyl]-1-[(1S)-2,2-dimethylcyclopentyl]-4-oxopyridine-3-carboxylic acid.
| Compound Name | 6-[6-chloro-5-(3-methoxypropoxy)-3-methyl-2-pyridinyl]-1-[(1S)-2,2-dimethylcyclopentyl]-4-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167262815 |
| Molecular Formula | C23H29ClN2O5 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 6-[6-chloro-5-(3-methoxypropoxy)-3-methyl-2-pyridinyl]-1-[(1S)-2,2-dimethylcyclopentyl]-4-oxopyridine-3-carboxylic acid |
| SMILES | COCCCOc1cc(C)c(-c2cc(=O)c(C(=O)O)cn2[C@H]2CCCC2(C)C)nc1Cl |
| InChI | InChI=1S/C23H29ClN2O5/c1-14-11-18(31-10-6-9-30-4)21(24)25-20(14)16-12-17(27)15(22(28)29)13-26(16)19-7-5-8-23(19,2)3/h11-13,19H,5-10H2,1-4H3,(H,28,29)/t19-/m0/s1 |
| InChIKey | UFKMFPPDAINCMD-IBGZPJMESA-N |
| XLogP | 4.74 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|