C23H29N3O5 — CID 167263037
2-formamido-N-[1-[4-(4-hydroxy-3-methylphenoxy)-3,5-dimethylphenyl]propan-2-yl]butanediamide (PubChem CID 167263037) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-formamido-N-[1-[4-(4-hydroxy-3-methylphenoxy)-3,5-dimethylphenyl]propan-2-yl]butanediamide.
| Compound Name | 2-formamido-N-[1-[4-(4-hydroxy-3-methylphenoxy)-3,5-dimethylphenyl]propan-2-yl]butanediamide |
|---|---|
| PubChem CID | 167263037 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-formamido-N-[1-[4-(4-hydroxy-3-methylphenoxy)-3,5-dimethylphenyl]propan-2-yl]butanediamide |
| SMILES | Cc1cc(Oc2c(C)cc(CC(C)NC(=O)C(CC(N)=O)NC=O)cc2C)ccc1O |
| InChI | InChI=1S/C23H29N3O5/c1-13-9-18(5-6-20(13)28)31-22-14(2)7-17(8-15(22)3)10-16(4)26-23(30)19(25-12-27)11-21(24)29/h5-9,12,16,19,28H,10-11H2,1-4H3,(H2,24,29)(H,25,27)(H,26,30) |
| InChIKey | CNLLWHHBNRIAQO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|