C24H34F3N5O — CID 167263124
[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(cyclohexylmethyl)-6-methyl-2-pyridinyl]prop-2-enyl] (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)but-2-enimidate (PubChem CID 167263124) has the molecular formula C24H34F3N5O and a molecular weight of 465.56 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(cyclohexylmethyl)-6-methyl-2-pyridinyl]prop-2-enyl] (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)but-2-enimidate.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(cyclohexylmethyl)-6-methyl-2-pyridinyl]prop-2-enyl] (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)but-2-enimidate |
|---|---|
| PubChem CID | 167263124 |
| Molecular Formula | C24H34F3N5O |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(cyclohexylmethyl)-6-methyl-2-pyridinyl]prop-2-enyl] (Z)-N-(3,3,3-trifluoroprop-1-en-2-yl)but-2-enimidate |
| SMILES | C=C(/N=C(\C=C/C)OC/C(=C(/N)c1ccc(CC2CCCCC2)c(C)n1)N(C)N)C(F)(F)F |
| InChI | InChI=1S/C24H34F3N5O/c1-5-9-22(31-17(3)24(25,26)27)33-15-21(32(4)29)23(28)20-13-12-19(16(2)30-20)14-18-10-7-6-8-11-18/h5,9,12-13,18H,3,6-8,10-11,14-15,28-29H2,1-2,4H3/b9-5-,23-21-,31-22+ |
| InChIKey | LYDVPGALGMGZIR-ASASNTLPSA-N |
| XLogP | 5.01 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|