C32H60O7Si — CID 16726353
methyl (E,5S,7S,9S)-10-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-5,7-dihydroxy-9-methoxydec-2-enoate (PubChem CID 16726353) has the molecular formula C32H60O7Si and a molecular weight of 584.91 g/mol. Its IUPAC name is methyl (E,5S,7S,9S)-10-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-5,7-dihydroxy-9-methoxydec-2-enoate.
| Compound Name | methyl (E,5S,7S,9S)-10-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-5,7-dihydroxy-9-methoxydec-2-enoate |
|---|---|
| PubChem CID | 16726353 |
| Molecular Formula | C32H60O7Si |
| Molecular Weight | 584.91 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | methyl (E,5S,7S,9S)-10-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-5,7-dihydroxy-9-methoxydec-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H](O)C[C@H](O)C[C@@H](C[C@H]1O[C@H](C[C@H](/C=C/CC(C)C)O[Si](C)(C)C(C)(C)C)CC[C@@H]1C)OC |
| InChI | InChI=1S/C32H60O7Si/c1-23(2)13-11-15-28(39-40(9,10)32(4,5)6)21-27-18-17-24(3)30(38-27)22-29(36-7)20-26(34)19-25(33)14-12-16-31(35)37-8/h11-12,15-16,23-30,33-34H,13-14,17-22H2,1-10H3/b15-11+,16-12+/t24-,25-,26-,27-,28-,29-,30+/m0/s1 |
| InChIKey | OMDBOZINQNRUDD-PDVCIUIXSA-N |
| XLogP | 6.58 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.91 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|