C16H22N2O — CID 167264283
2,4,7-trimethyl-3-[(2-methylimidazol-1-yl)methyl]cyclohepta-1,6-diene-1-carbaldehyde (PubChem CID 167264283) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 2,4,7-trimethyl-3-[(2-methylimidazol-1-yl)methyl]cyclohepta-1,6-diene-1-carbaldehyde.
| Compound Name | 2,4,7-trimethyl-3-[(2-methylimidazol-1-yl)methyl]cyclohepta-1,6-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 167264283 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2,4,7-trimethyl-3-[(2-methylimidazol-1-yl)methyl]cyclohepta-1,6-diene-1-carbaldehyde |
| SMILES | CC1=CCC(C)C(Cn2ccnc2C)C(C)=C1C=O |
| InChI | InChI=1S/C16H22N2O/c1-11-5-6-12(2)16(10-19)13(3)15(11)9-18-8-7-17-14(18)4/h6-8,10-11,15H,5,9H2,1-4H3 |
| InChIKey | UIBKTCQBAJRLGC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|