C23H25FN6O — CID 167264364
17-amino-15-butyl-7-cyclopropyl-12-fluoro-4-methyl-4,5,7,15,18-pentazatetracyclo[14.3.1.02,6.09,14]icosa-1(20),2,5,9(14),10,12,16,18-octaen-8-one (PubChem CID 167264364) has the molecular formula C23H25FN6O and a molecular weight of 420.49 g/mol. Its IUPAC name is 17-amino-15-butyl-7-cyclopropyl-12-fluoro-4-methyl-4,5,7,15,18-pentazatetracyclo[14.3.1.02,6.09,14]icosa-1(20),2,5,9(14),10,12,16,18-octaen-8-one.
| Compound Name | 17-amino-15-butyl-7-cyclopropyl-12-fluoro-4-methyl-4,5,7,15,18-pentazatetracyclo[14.3.1.02,6.09,14]icosa-1(20),2,5,9(14),10,12,16,18-octaen-8-one |
|---|---|
| PubChem CID | 167264364 |
| Molecular Formula | C23H25FN6O |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 17-amino-15-butyl-7-cyclopropyl-12-fluoro-4-methyl-4,5,7,15,18-pentazatetracyclo[14.3.1.02,6.09,14]icosa-1(20),2,5,9(14),10,12,16,18-octaen-8-one |
| SMILES | CCCCN1c2cc(F)ccc2C(=O)N(C2CC2)c2nn(C)cc2-c2cnc(N)c1c2 |
| InChI | InChI=1S/C23H25FN6O/c1-3-4-9-29-19-11-15(24)5-8-17(19)23(31)30(16-6-7-16)22-18(13-28(2)27-22)14-10-20(29)21(25)26-12-14/h5,8,10-13,16H,3-4,6-7,9H2,1-2H3,(H2,25,26) |
| InChIKey | CHLKQSFLDWTTOB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|