About (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione
(3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione (PubChem CID 167264514) has the molecular formula C15H17F2NO3
and a molecular weight of 297.30 g/mol. Its IUPAC name is (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione.
Molecular Properties
| Compound Name | (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione |
| PubChem CID | 167264514 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](c2c(F)cc(CCCCO)cc2F)C(=O)N1 |
| InChI | InChI=1S/C15H17F2NO3/c16-11-7-9(3-1-2-6-19)8-12(17)14(11)10-4-5-13(20)18-15(10)21/h7-8,10,19H,1-6H2,(H,18,20,21)/t10-/m1/s1 |
| InChIKey | FLFFXFMABVJANL-SNVBAGLBSA-N |
| XLogP | 1.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione?
The IUPAC name of (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione (CID 167264514) is (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione.
What is the SMILES notation for (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione?
The canonical SMILES for (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione is O=C1CC[C@H](c2c(F)cc(CCCCO)cc2F)C(=O)N1.
What is the InChIKey of (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione?
The InChIKey is FLFFXFMABVJANL-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H17F2NO3/c16-11-7-9(3-1-2-6-19)8-12(17)14(11)10-4-5-13(20)18-15(10)21/h7-8,10,19H,1-6H2,(H,18,20,21)/t10-/m1/s1.
What are the key properties of (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione?
(3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione has a molecular weight of 297.30 g/mol, XLogP of 1.80, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[2,6-difluoro-4-(4-hydroxybutyl)phenyl]piperidine-2,6-dione is sourced from PubChem (CID 167264514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).