C25H28IN3O3S — CID 167264616
1-[4-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)cyclohexa-1,3-dien-1-yl]-3-[iodo(phenyl)methyl]-1,3-dimethylurea (PubChem CID 167264616) has the molecular formula C25H28IN3O3S and a molecular weight of 577.49 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)cyclohexa-1,3-dien-1-yl]-3-[iodo(phenyl)methyl]-1,3-dimethylurea.
| Compound Name | 1-[4-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)cyclohexa-1,3-dien-1-yl]-3-[iodo(phenyl)methyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 167264616 |
| Molecular Formula | C25H28IN3O3S |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 1-[4-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)cyclohexa-1,3-dien-1-yl]-3-[iodo(phenyl)methyl]-1,3-dimethylurea |
| SMILES | CN(C(=O)N(C)C(I)c1ccccc1)C1=CC=C(S(=O)(=O)Cc2ccc3c(c2)CNC3)CC1 |
| InChI | InChI=1S/C25H28IN3O3S/c1-28(25(30)29(2)24(26)19-6-4-3-5-7-19)22-10-12-23(13-11-22)33(31,32)17-18-8-9-20-15-27-16-21(20)14-18/h3-10,12,14,24,27H,11,13,15-17H2,1-2H3 |
| InChIKey | GCBYGHKBVSDCEG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|