About [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine
[5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine (PubChem CID 167264952) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine |
| PubChem CID | 167264952 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine |
| SMILES | NCN1CC2(CCCN2C2COC2)C1 |
| InChI | InChI=1S/C10H19N3O/c11-8-12-6-10(7-12)2-1-3-13(10)9-4-14-5-9/h9H,1-8,11H2 |
| InChIKey | VRWQYGLWKBBACK-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine?
The IUPAC name of [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine (CID 167264952) is [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine.
What is the SMILES notation for [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine?
The canonical SMILES for [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine is NCN1CC2(CCCN2C2COC2)C1.
What is the InChIKey of [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine?
The InChIKey is VRWQYGLWKBBACK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c11-8-12-6-10(7-12)2-1-3-13(10)9-4-14-5-9/h9H,1-8,11H2.
What are the key properties of [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine?
[5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine has a molecular weight of 197.28 g/mol, XLogP of -0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(oxetan-3-yl)-2,5-diazaspiro[3.4]octan-2-yl]methanamine is sourced from PubChem (CID 167264952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).