C33H52FN — CID 167265238
(3E,10Z)-8-ethyl-14-fluoro-5,10-dimethyl-3-[(3Z)-2-methylhepta-1,3,6-trien-3-yl]-7-methylidene-N-prop-2-enyl-8-propyltetradeca-3,10-dien-2-imine (PubChem CID 167265238) has the molecular formula C33H52FN and a molecular weight of 481.78 g/mol. Its IUPAC name is (3E,10Z)-8-ethyl-14-fluoro-5,10-dimethyl-3-[(3Z)-2-methylhepta-1,3,6-trien-3-yl]-7-methylidene-N-prop-2-enyl-8-propyltetradeca-3,10-dien-2-imine.
| Compound Name | (3E,10Z)-8-ethyl-14-fluoro-5,10-dimethyl-3-[(3Z)-2-methylhepta-1,3,6-trien-3-yl]-7-methylidene-N-prop-2-enyl-8-propyltetradeca-3,10-dien-2-imine |
|---|---|
| PubChem CID | 167265238 |
| Molecular Formula | C33H52FN |
| Molecular Weight | 481.78 g/mol |
| Exact Mass | 481.41 |
| IUPAC Name | (3E,10Z)-8-ethyl-14-fluoro-5,10-dimethyl-3-[(3Z)-2-methylhepta-1,3,6-trien-3-yl]-7-methylidene-N-prop-2-enyl-8-propyltetradeca-3,10-dien-2-imine |
| SMILES | C=CC/C=C(C(=C)C)\C(=C/C(C)CC(=C)C(CC)(CCC)C/C(C)=C\CCCF)C(\C)=N\CC=C |
| InChI | InChI=1S/C33H52FN/c1-11-15-19-31(26(5)6)32(30(10)35-22-13-3)24-28(8)23-29(9)33(14-4,20-12-2)25-27(7)18-16-17-21-34/h11,13,18-19,24,28H,1,3,5,9,12,14-17,20-23,25H2,2,4,6-8,10H3/b27-18-,31-19-,32-24-,35-30+ |
| InChIKey | GOHVOPGSGCVUSB-KFHORHQNSA-N |
| XLogP | 10.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.78 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|