C22H25N3S — CID 167265514
(1R,2R)-N-methyl-N-methylsulfanyl-1,2-diphenyl-N'-[(Z)-1H-pyridin-2-ylidenemethyl]ethane-1,2-diamine (PubChem CID 167265514) has the molecular formula C22H25N3S and a molecular weight of 363.53 g/mol. Its IUPAC name is (1R,2R)-N-methyl-N-methylsulfanyl-1,2-diphenyl-N'-[(Z)-1H-pyridin-2-ylidenemethyl]ethane-1,2-diamine.
| Compound Name | (1R,2R)-N-methyl-N-methylsulfanyl-1,2-diphenyl-N'-[(Z)-1H-pyridin-2-ylidenemethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 167265514 |
| Molecular Formula | C22H25N3S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (1R,2R)-N-methyl-N-methylsulfanyl-1,2-diphenyl-N'-[(Z)-1H-pyridin-2-ylidenemethyl]ethane-1,2-diamine |
| SMILES | CSN(C)[C@H](c1ccccc1)[C@H](N/C=C1/C=CC=CN1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3S/c1-25(26-2)22(19-13-7-4-8-14-19)21(18-11-5-3-6-12-18)24-17-20-15-9-10-16-23-20/h3-17,21-24H,1-2H3/b20-17-/t21-,22-/m1/s1 |
| InChIKey | YOLWFLBQOVRAPN-GTKRQRKWSA-N |
| XLogP | 4.78 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|