C53H41N — CID 167266008
3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-[4-(4-phenylphenyl)phenyl]aniline (PubChem CID 167266008) has the molecular formula C53H41N and a molecular weight of 691.92 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-[4-(4-phenylphenyl)phenyl]aniline.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-[4-(4-phenylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 167266008 |
| Molecular Formula | C53H41N |
| Molecular Weight | 691.92 g/mol |
| Exact Mass | 691.32 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-[4-(4-phenylphenyl)phenyl]aniline |
| SMILES | C=C/C(=C\C=C/C)c1cccc(N(c2ccc(-c3ccc(-c4ccccc4)cc3)cc2)c2ccc(-c3c(-c4ccccc4)ccc4ccccc34)cc2)c1 |
| InChI | InChI=1S/C53H41N/c1-3-5-15-39(4-2)47-21-14-22-50(38-47)54(48-33-28-43(29-34-48)42-26-24-41(25-27-42)40-16-8-6-9-17-40)49-35-30-46(31-36-49)53-51-23-13-12-20-45(51)32-37-52(53)44-18-10-7-11-19-44/h3-38H,2H2,1H3/b5-3-,39-15+ |
| InChIKey | ARCCFGIKNJTXDJ-WEJMLGGUSA-N |
| XLogP | 15.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.92 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|