C29H44F2N2 — CID 167266190
N-[(3Z)-1-[(3R)-1-[(4Z,7E)-7-ethyl-8,9-difluoro-2-methyldeca-4,7,9-trienyl]-3-propan-2-yl-3,4,5,8-tetrahydro-2H-azocin-5-yl]penta-1,3-dien-2-yl]methanimine (PubChem CID 167266190) has the molecular formula C29H44F2N2 and a molecular weight of 458.68 g/mol. Its IUPAC name is N-[(3Z)-1-[(3R)-1-[(4Z,7E)-7-ethyl-8,9-difluoro-2-methyldeca-4,7,9-trienyl]-3-propan-2-yl-3,4,5,8-tetrahydro-2H-azocin-5-yl]penta-1,3-dien-2-yl]methanimine.
| Compound Name | N-[(3Z)-1-[(3R)-1-[(4Z,7E)-7-ethyl-8,9-difluoro-2-methyldeca-4,7,9-trienyl]-3-propan-2-yl-3,4,5,8-tetrahydro-2H-azocin-5-yl]penta-1,3-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 167266190 |
| Molecular Formula | C29H44F2N2 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.35 |
| IUPAC Name | N-[(3Z)-1-[(3R)-1-[(4Z,7E)-7-ethyl-8,9-difluoro-2-methyldeca-4,7,9-trienyl]-3-propan-2-yl-3,4,5,8-tetrahydro-2H-azocin-5-yl]penta-1,3-dien-2-yl]methanimine |
| SMILES | C=NC(=CC1C=CCN(CC(C)C/C=C\C/C(CC)=C(/F)C(=C)F)C[C@@H](C(C)C)C1)/C=C\C |
| InChI | InChI=1S/C29H44F2N2/c1-8-13-28(32-7)19-25-15-12-17-33(21-27(18-25)22(3)4)20-23(5)14-10-11-16-26(9-2)29(31)24(6)30/h8,10-13,15,19,22-23,25,27H,6-7,9,14,16-18,20-21H2,1-5H3/b11-10-,13-8-,15-12?,28-19?,29-26+/t23?,25?,27-/m0/s1 |
| InChIKey | ZYYVXZKZFAUUKZ-VSBZYIMYSA-N |
| XLogP | 8.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|