C21H22FN3O3S — CID 167266536
(4aR,6S,8R)-7-azido-6-(2,4-dimethylphenyl)sulfanyl-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 167266536) has the molecular formula C21H22FN3O3S and a molecular weight of 415.49 g/mol. Its IUPAC name is (4aR,6S,8R)-7-azido-6-(2,4-dimethylphenyl)sulfanyl-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,8R)-7-azido-6-(2,4-dimethylphenyl)sulfanyl-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 167266536 |
| Molecular Formula | C21H22FN3O3S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (4aR,6S,8R)-7-azido-6-(2,4-dimethylphenyl)sulfanyl-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | Cc1ccc(S[C@@H]2O[C@@H]3COC(c4ccccc4)OC3[C@H](F)C2N=[N+]=[N-])c(C)c1 |
| InChI | InChI=1S/C21H22FN3O3S/c1-12-8-9-16(13(2)10-12)29-21-18(24-25-23)17(22)19-15(27-21)11-26-20(28-19)14-6-4-3-5-7-14/h3-10,15,17-21H,11H2,1-2H3/t15-,17-,18?,19?,20?,21+/m1/s1 |
| InChIKey | RINQPGSCAREQEE-MSIKWNGDSA-N |
| XLogP | 5.25 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|