About (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine
(2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine (PubChem CID 167266674) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine.
Molecular Properties
| Compound Name | (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine |
| PubChem CID | 167266674 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine |
| SMILES | CCCCN1CN(/C=C2/C=CC=CN2)C(C)=C1C |
| InChI | InChI=1S/C15H23N3/c1-4-5-10-17-12-18(14(3)13(17)2)11-15-8-6-7-9-16-15/h6-9,11,16H,4-5,10,12H2,1-3H3/b15-11- |
| InChIKey | QKDAJJYQVIGQLC-PTNGSMBKSA-N |
| XLogP | 3.13 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine?
The IUPAC name of (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine (CID 167266674) is (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine.
What is the SMILES notation for (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine?
The canonical SMILES for (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine is CCCCN1CN(/C=C2/C=CC=CN2)C(C)=C1C.
What is the InChIKey of (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine?
The InChIKey is QKDAJJYQVIGQLC-PTNGSMBKSA-N. The full InChI is InChI=1S/C15H23N3/c1-4-5-10-17-12-18(14(3)13(17)2)11-15-8-6-7-9-16-15/h6-9,11,16H,4-5,10,12H2,1-3H3/b15-11-.
What are the key properties of (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine?
(2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine has a molecular weight of 245.37 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(3-butyl-4,5-dimethyl-2H-imidazol-1-yl)methylidene]-1H-pyridine is sourced from PubChem (CID 167266674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).