C17H28N2O2 — CID 167266912
(11S)-2,2-diethyl-7,10-dimethyl-4,13-dioxa-14,15-diazatricyclo[9.2.1.13,6]pentadeca-1(14),3(15)-diene (PubChem CID 167266912) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (11S)-2,2-diethyl-7,10-dimethyl-4,13-dioxa-14,15-diazatricyclo[9.2.1.13,6]pentadeca-1(14),3(15)-diene.
| Compound Name | (11S)-2,2-diethyl-7,10-dimethyl-4,13-dioxa-14,15-diazatricyclo[9.2.1.13,6]pentadeca-1(14),3(15)-diene |
|---|---|
| PubChem CID | 167266912 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (11S)-2,2-diethyl-7,10-dimethyl-4,13-dioxa-14,15-diazatricyclo[9.2.1.13,6]pentadeca-1(14),3(15)-diene |
| SMILES | CCC1(CC)C2=NC(CO2)C(C)CCC(C)[C@H]2COC1=N2 |
| InChI | InChI=1S/C17H28N2O2/c1-5-17(6-2)15-18-13(9-20-15)11(3)7-8-12(4)14-10-21-16(17)19-14/h11-14H,5-10H2,1-4H3/t11?,12?,13-,14?/m1/s1 |
| InChIKey | GZDHJRHBIKJVFX-WCFLAILDSA-N |
| XLogP | 3.45 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |