C28H26F6NO2P — CID 16726702
[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-methoxyphenyl]-bis[4-(trifluoromethyl)phenyl]phosphane (PubChem CID 16726702) has the molecular formula C28H26F6NO2P and a molecular weight of 553.48 g/mol. Its IUPAC name is [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-methoxyphenyl]-bis[4-(trifluoromethyl)phenyl]phosphane.
| Compound Name | [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-methoxyphenyl]-bis[4-(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 16726702 |
| Molecular Formula | C28H26F6NO2P |
| Molecular Weight | 553.48 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | [2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-4-methoxyphenyl]-bis[4-(trifluoromethyl)phenyl]phosphane |
| SMILES | COc1ccc(P(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)c(C2=N[C@@H](C(C)(C)C)CO2)c1 |
| InChI | InChI=1S/C28H26F6NO2P/c1-26(2,3)24-16-37-25(35-24)22-15-19(36-4)9-14-23(22)38(20-10-5-17(6-11-20)27(29,30)31)21-12-7-18(8-13-21)28(32,33)34/h5-15,24H,16H2,1-4H3/t24-/m1/s1 |
| InChIKey | BBLLHBILMMVAIJ-XMMPIXPASA-N |
| XLogP | 6.68 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|