C18H22O3 — CID 16726704
methyl (1S,3S,5S,9R)-3-ethenyl-14-oxotricyclo[7.4.1.01,5]tetradeca-6,11-diene-9-carboxylate (PubChem CID 16726704) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl (1S,3S,5S,9R)-3-ethenyl-14-oxotricyclo[7.4.1.01,5]tetradeca-6,11-diene-9-carboxylate.
| Compound Name | methyl (1S,3S,5S,9R)-3-ethenyl-14-oxotricyclo[7.4.1.01,5]tetradeca-6,11-diene-9-carboxylate |
|---|---|
| PubChem CID | 16726704 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | methyl (1S,3S,5S,9R)-3-ethenyl-14-oxotricyclo[7.4.1.01,5]tetradeca-6,11-diene-9-carboxylate |
| SMILES | C=C[C@H]1C[C@H]2C=CC[C@]3(C(=O)OC)CC=CC[C@@]2(C1)C3=O |
| InChI | InChI=1S/C18H22O3/c1-3-13-11-14-7-6-10-17(16(20)21-2)8-4-5-9-18(14,12-13)15(17)19/h3-7,13-14H,1,8-12H2,2H3/t13-,14+,17+,18-/m0/s1 |
| InChIKey | CSJJCCTURASCBR-JFTQMJAMSA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|