About 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione
3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione (PubChem CID 167267062) has the molecular formula C11H17NS3
and a molecular weight of 259.46 g/mol. Its IUPAC name is 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione.
Molecular Properties
| Compound Name | 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione |
| PubChem CID | 167267062 |
| Molecular Formula | C11H17NS3 |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione |
| SMILES | CC(C)(C)CCCNc1c(S)c(=S)c1=S |
| InChI | InChI=1S/C11H17NS3/c1-11(2,3)5-4-6-12-7-8(13)10(15)9(7)14/h12-13H,4-6H2,1-3H3 |
| InChIKey | OVJNMXXMMFDXIA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione?
The IUPAC name of 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione (CID 167267062) is 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione.
What is the SMILES notation for 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione?
The canonical SMILES for 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione is CC(C)(C)CCCNc1c(S)c(=S)c1=S.
What is the InChIKey of 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione?
The InChIKey is OVJNMXXMMFDXIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NS3/c1-11(2,3)5-4-6-12-7-8(13)10(15)9(7)14/h12-13H,4-6H2,1-3H3.
What are the key properties of 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione?
3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione has a molecular weight of 259.46 g/mol, XLogP of 4.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-dimethylpentylamino)-4-sulfanylcyclobut-3-ene-1,2-dithione is sourced from PubChem (CID 167267062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).