About (2S)-2-(azidomethyl)-4,4-difluorooxane
(2S)-2-(azidomethyl)-4,4-difluorooxane (PubChem CID 167267086) has the molecular formula C6H9F2N3O
and a molecular weight of 177.15 g/mol. Its IUPAC name is (2S)-2-(azidomethyl)-4,4-difluorooxane.
Molecular Properties
| Compound Name | (2S)-2-(azidomethyl)-4,4-difluorooxane |
| PubChem CID | 167267086 |
| Molecular Formula | C6H9F2N3O |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | (2S)-2-(azidomethyl)-4,4-difluorooxane |
| SMILES | [N-]=[N+]=NC[C@@H]1CC(F)(F)CCO1 |
| InChI | InChI=1S/C6H9F2N3O/c7-6(8)1-2-12-5(3-6)4-10-11-9/h5H,1-4H2/t5-/m0/s1 |
| InChIKey | YIEDPWMTWJWAQA-YFKPBYRVSA-N |
| XLogP | 2.11 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(azidomethyl)-4,4-difluorooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(azidomethyl)-4,4-difluorooxane?
The IUPAC name of (2S)-2-(azidomethyl)-4,4-difluorooxane (CID 167267086) is (2S)-2-(azidomethyl)-4,4-difluorooxane.
What is the SMILES notation for (2S)-2-(azidomethyl)-4,4-difluorooxane?
The canonical SMILES for (2S)-2-(azidomethyl)-4,4-difluorooxane is [N-]=[N+]=NC[C@@H]1CC(F)(F)CCO1.
What is the InChIKey of (2S)-2-(azidomethyl)-4,4-difluorooxane?
The InChIKey is YIEDPWMTWJWAQA-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H9F2N3O/c7-6(8)1-2-12-5(3-6)4-10-11-9/h5H,1-4H2/t5-/m0/s1.
What are the key properties of (2S)-2-(azidomethyl)-4,4-difluorooxane?
(2S)-2-(azidomethyl)-4,4-difluorooxane has a molecular weight of 177.15 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(azidomethyl)-4,4-difluorooxane is sourced from PubChem (CID 167267086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).