C8H9Cl3F3N5O2 — CID 167267417
[3-amino-6-(azidomethyl)-4,5,5-trifluorooxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 167267417) has the molecular formula C8H9Cl3F3N5O2 and a molecular weight of 370.55 g/mol. Its IUPAC name is [3-amino-6-(azidomethyl)-4,5,5-trifluorooxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [3-amino-6-(azidomethyl)-4,5,5-trifluorooxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 167267417 |
| Molecular Formula | C8H9Cl3F3N5O2 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | [3-amino-6-(azidomethyl)-4,5,5-trifluorooxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1OC(CN=[N+]=[N-])C(F)(F)C(F)C1N)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H9Cl3F3N5O2/c9-8(10,11)6(16)21-5-3(15)4(12)7(13,14)2(20-5)1-18-19-17/h2-5,16H,1,15H2/b16-6+ |
| InChIKey | DQGPBWLIAAREFK-OMCISZLKSA-N |
| XLogP | 2.69 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|